Difference between revisions of "Ec-18 002590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] == * smiles:...")
 
(Created page with "Category:Gene == Gene Ec-02_001880 == * left end position: ** 2155523 * transcription direction: ** POSITIVE * right end position: ** 2162633 * centisome position: ** 33.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] ==
+
== Gene Ec-02_001880 ==
−
* smiles:
+
* left end position:
−
** CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
+
** 2155523
−
* common name:
+
* transcription direction:
−
** α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
+
** POSITIVE
 +
* right end position:
 +
** 2162633
 +
* centisome position:
 +
** 33.02071   
 
* Synonym(s):
 
* Synonym(s):
−
** α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein
+
** Esi_0055_0078
 +
** Esi0055_0078
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PEROXID-RXN]]
−
* [[2.4.99.6-RXN]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
* [[RXN-14240]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-15288]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-17352]]
 +
** esiliculosus_genome
 +
***go-term
 +
* [[RXN-8635]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=2155523}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04907 C04907]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}}
+
{{#set: right end position=2162633}}
−
{{#set: common name=α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}}
+
{{#set: centisome position=33.02071    }}
−
{{#set: common name=α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein}}
+
{{#set: common name=Esi_0055_0078|Esi0055_0078}}
−
{{#set: produced by=2.4.99.6-RXN}}
+
{{#set: reaction associated=PEROXID-RXN|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
 +
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}

Revision as of 22:05, 17 March 2018

Gene Ec-02_001880

  • left end position:
    • 2155523
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2162633
  • centisome position:
    • 33.02071
  • Synonym(s):
    • Esi_0055_0078
    • Esi0055_0078

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_002590&oldid=15758"