Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_010520 == * left end position: ** 8859494 * transcription direction: ** NEGATIVE * right end position: ** 8866184 * centisome position: ** 85.8...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * smiles: ** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_010520 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] ==
−
* left end position:
+
* smiles:
−
** 8859494
+
** CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J
−
* right end position:
+
* common name:
−
** 8866184
+
** sapienoyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 85.85751    
+
** 999.899    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0163_0045
+
** Δ6-hexadecenoyl-CoA
−
** Esi0163_0045
+
** (6Z)-hexadec-6-enoyl-CoA
 +
** (6Z)-hexadecenoyl-CoA
 +
** 16:1, n-10, cis-6 hexadecenoyl-CoA
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-1281]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-16065]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8859494}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627261 71627261]
−
{{#set: right end position=8866184}}
+
* CHEBI:
−
{{#set: centisome position=85.85751   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74339 74339]
−
{{#set: common name=Esi_0163_0045|Esi0163_0045}}
+
{{#set: smiles=CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
−
{{#set: reaction associated=RXN0-1281}}
+
{{#set: inchi key=InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J}}
 +
{{#set: common name=sapienoyl-CoA}}
 +
{{#set: molecular weight=999.899   }}
 +
{{#set: common name=Δ6-hexadecenoyl-CoA|(6Z)-hexadec-6-enoyl-CoA|(6Z)-hexadecenoyl-CoA|16:1, n-10, cis-6 hexadecenoyl-CoA}}
 +
{{#set: produced by=RXN-16065}}

Revision as of 22:05, 17 March 2018

Metabolite CPD-17313

  • smiles:
    • CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=PVZUHJMOMJKUEF-HATLACBZSA-J
  • common name:
    • sapienoyl-CoA
  • molecular weight:
    • 999.899
  • Synonym(s):
    • Δ6-hexadecenoyl-CoA
    • (6Z)-hexadec-6-enoyl-CoA
    • (6Z)-hexadecenoyl-CoA
    • 16:1, n-10, cis-6 hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER&oldid=15761"