Difference between revisions of "Ec-02 001820"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...")
 
(Created page with "Category:Gene == Gene Ec-02_000280 == * left end position: ** 279080 * transcription direction: ** NEGATIVE * right end position: ** 284171 * centisome position: ** 4.2752...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
+
== Gene Ec-02_000280 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 279080
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-oxoadipyl-CoA
+
** 284171
−
* molecular weight:
+
* centisome position:
−
** 904.605    
+
** 4.2752595    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-ketoadipyl-CoA
+
** Esi_0083_0048
−
** 3-keto-adipyl-coa
+
** Esi0083_0048
−
** β-ketoadipyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN0-2044]]
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=279080}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=284171}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348]
+
{{#set: centisome position=4.2752595   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0083_0048|Esi0083_0048}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232]
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
* HMDB : HMDB60378
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}}
+
−
{{#set: common name=3-oxoadipyl-CoA}}
+
−
{{#set: molecular weight=904.605   }}
+
−
{{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}}
+
−
{{#set: consumed or produced by=RXN0-2044}}
+

Revision as of 22:06, 17 March 2018

Gene Ec-02_000280

  • left end position:
    • 279080
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 284171
  • centisome position:
    • 4.2752595
  • Synonym(s):
    • Esi_0083_0048
    • Esi0083_0048

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-02_001820&oldid=15778"