Difference between revisions of "Apo-Transcarboxylases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
 
(Created page with "Category:Gene == Gene Ec-19_003690 == * left end position: ** 3929503 * transcription direction: ** POSITIVE * right end position: ** 3940984 * centisome position: ** 65.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
+
== Gene Ec-19_003690 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3929503
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-methylhex-4-enoyl-CoA
+
** 3940984
−
* molecular weight:
+
* centisome position:
−
** 873.658    
+
** 65.81324    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0088_0011
 +
** Esi0088_0011
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
* [[RXN-11917]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3929503}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=3940984}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470]
+
{{#set: centisome position=65.81324    }}
−
{{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0088_0011|Esi0088_0011}}
−
{{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: common name=5-methylhex-4-enoyl-CoA}}
+
−
{{#set: molecular weight=873.658    }}
+
−
{{#set: produced by=RXN-11917}}
+

Revision as of 22:08, 17 March 2018

Gene Ec-19_003690

  • left end position:
    • 3929503
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3940984
  • centisome position:
    • 65.81324
  • Synonym(s):
    • Esi_0088_0011
    • Esi0088_0011

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Apo-Transcarboxylases&oldid=15903"