Difference between revisions of "PWY-7301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Fucopyranoses L-Fucopyranoses] == * common name: ** L-fucopyranose * Synonym(s): ** 6-deoxy-L...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == |
+ | * smiles: | ||
+ | ** C(C1(C(O)C(O)C(O)O1))O | ||
+ | * inchi key: | ||
+ | ** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-ribofuranose |
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-14904]] |
+ | * [[RXN0-5305]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16639 C16639] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.394477.html 394477] |
− | {{#set: reversible reaction associated=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ||
+ | {{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | ||
+ | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}} | ||
+ | {{#set: common name=β-D-ribofuranose}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: reversible reaction associated=RXN-14904|RXN0-5305}} |
Revision as of 13:10, 21 March 2018
Contents
Metabolite CPD0-1108
- smiles:
- C(C1(C(O)C(O)C(O)O1))O
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
- common name:
- β-D-ribofuranose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links