Difference between revisions of "Ec-27 004040"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHITOBIOSE CHITOBIOSE] == * common name: ** N,N'-diacetylchitobiose * Synonym(s): ** diacetylch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == |
+ | * smiles: | ||
+ | ** CC1(OC(C(C(C1O)O)O)O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** β-L-fucopyranose |
+ | * molecular weight: | ||
+ | ** 164.158 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β-L-fucose |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN0-5298]] | ||
== External links == | == External links == | ||
− | + | * DRUGBANK : DB03283 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863] |
− | {{#set: | + | * HMDB : HMDB59625 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.392667.html 392667] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589] | ||
+ | {{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}} | ||
+ | {{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}} | ||
+ | {{#set: common name=β-L-fucopyranose}} | ||
+ | {{#set: molecular weight=164.158 }} | ||
+ | {{#set: common name=β-L-fucose}} | ||
+ | {{#set: reversible reaction associated=RXN0-5298}} |
Revision as of 14:10, 21 March 2018
Contents
Metabolite CPD0-1107
- smiles:
- CC1(OC(C(C(C1O)O)O)O)
- inchi key:
- InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
- common name:
- β-L-fucopyranose
- molecular weight:
- 164.158
- Synonym(s):
- β-L-fucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB03283
- PUBCHEM:
- HMDB : HMDB59625
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: