Difference between revisions of "CPD-482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
(Created page with "Category:Gene == Gene Ec-01_003040 == * left end position: ** 2600899 * transcription direction: ** NEGATIVE * right end position: ** 2609947 * centisome position: ** 25.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
+
== Gene Ec-01_003040 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 2600899
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** gibberellin A51
+
** 2609947
−
* molecular weight:
+
* centisome position:
−
** 331.388    
+
** 25.205359    
 
* Synonym(s):
 
* Synonym(s):
−
** GA51
+
** Esi_0003_0183
 +
** Esi0003_0183
 +
** GSKa
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-171]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[RXN-8443]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[TAU-PROTEIN-KINASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170022
+
{{#set: left end position=2600899}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
+
{{#set: right end position=2609947}}
−
* CHEBI:
+
{{#set: centisome position=25.205359   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
+
{{#set: common name=Esi_0003_0183|Esi0003_0183|GSKa}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443|TAU-PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
+
{{#set: pathway associated=PWY-5381}}
−
* HMDB : HMDB35041
+
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
+
−
{{#set: common name=gibberellin A51}}
+
−
{{#set: molecular weight=331.388   }}
+
−
{{#set: common name=GA51}}
+
−
{{#set: produced by=RXN-171}}
+

Revision as of 13:10, 21 March 2018

Gene Ec-01_003040

  • left end position:
    • 2600899
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2609947
  • centisome position:
    • 25.205359
  • Synonym(s):
    • Esi_0003_0183
    • Esi0003_0183
    • GSKa

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-482&oldid=16148"