Difference between revisions of "RXN-14642"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Gene == Gene Ec-03_005020 == * left end position: ** 5934661 * transcription direction: ** NEGATIVE * right end position: ** 5955650 * centisome position: ** 90.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_005020 == |
− | * | + | * left end position: |
− | ** | + | ** 5934661 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5955650 |
− | * | + | * centisome position: |
− | ** | + | ** 90.90166 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0050_0096 |
+ | ** Esi0050_0096 | ||
+ | ** MAPK | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5934661}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5955650}} | |
− | + | {{#set: centisome position=90.90166 }} | |
− | + | {{#set: common name=Esi_0050_0096|Esi0050_0096|MAPK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:10, 21 March 2018
Gene Ec-03_005020
- left end position:
- 5934661
- transcription direction:
- NEGATIVE
- right end position:
- 5955650
- centisome position:
- 90.90166
- Synonym(s):
- Esi_0050_0096
- Esi0050_0096
- MAPK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome