Difference between revisions of "3-oxo-D5-steroids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14047 RXN-14047] == * direction: ** REVERSIBLE * common name: ** Aconitate hydratase, ** Aconit...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14047 RXN-14047] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
** Aconitate hydratase,
−
* molecular weight:
+
** Aconitase/3-isopropylmalate dehydratase, swivel
−
** 985.829   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.3 EC-4.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-14:1-Δ7-CoA
 
−
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17794]]
+
** 1 [[CIT]][c] '''<=>''' 1 [[THREO-DS-ISO-CITRATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 citrate[c] '''<=>''' 1 D-threo-isocitrate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_001000]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R01324 R01324]
−
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: molecular weight=985.829    }}
+
{{#set: common name=Aconitate hydratase,}}
−
{{#set: common name=3-oxo-14:1-&Delta;7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=Aconitase/3-isopropylmalate dehydratase, swivel}}
−
{{#set: produced by=RXN-17794}}
+
{{#set: ec number=EC-4.2.1.3}}
 +
{{#set: gene associated=Ec-16_001000|Ec-12_000170}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:10, 21 March 2018

Reaction RXN-14047

  • direction:
    • REVERSIBLE
  • common name:
    • Aconitate hydratase,
    • Aconitase/3-isopropylmalate dehydratase, swivel
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 citrate[c] <=> 1 D-threo-isocitrate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-oxo-D5-steroids&oldid=16193"