Difference between revisions of "CPD-10330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNPOXI-RXN PNPOXI-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** pyridoxamine-phosphate ox...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PNPOXI-RXN PNPOXI-RXN] ==
−
* smiles:
+
* direction:
−
** C(C1(C(C(C(O1)O)O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
 
* common name:
 
* common name:
−
** α-D-ribofuranose
+
** pyridoxamine-phosphate oxidase
−
* molecular weight:
+
* ec number:
−
** 150.131   
+
** [http://enzyme.expasy.org/EC/1.4.3.5 EC-1.4.3.5]
 
* Synonym(s):
 
* Synonym(s):
−
** α D-ribose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RIBOKIN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PYRIDOXINE-5P]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PYRIDOXAL_PHOSPHATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-14904]]
+
** 1 pyridoxine 5'-phosphate[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 pyridoxal 5'-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_000340]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-09_002030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-10_006030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
 +
** '''5''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
 +
** '''5''' reactions found over '''9''' reactions in the full pathway
 +
* [[PLPSAL-PWY]], pyridoxal 5'-phosphate salvage I: [http://metacyc.org/META/NEW-IMAGE?object=PLPSAL-PWY PLPSAL-PWY]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PYRIDOXSYN-PWY]], pyridoxal 5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15149 15149]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00278 R00278]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
{{#set: common name=pyridoxamine-phosphate oxidase}}
−
* HMDB : HMDB00283
+
{{#set: ec number=EC-1.4.3.5}}
−
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
{{#set: gene associated=Ec-01_000340|Ec-09_002030|Ec-10_006030}}
−
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
{{#set: in pathway=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}}
−
{{#set: common name=α-D-ribofuranose}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=150.131    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=α D-ribose}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RIBOKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14904}}
+

Revision as of 14:10, 21 March 2018

Reaction PNPOXI-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • pyridoxamine-phosphate oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7204, pyridoxal 5'-phosphate salvage II (plants): PWY-7204
    • 5 reactions found over 9 reactions in the full pathway
  • PWY-7282, 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): PWY-7282
    • 5 reactions found over 9 reactions in the full pathway
  • PLPSAL-PWY, pyridoxal 5'-phosphate salvage I: PLPSAL-PWY
    • 5 reactions found over 5 reactions in the full pathway
  • PYRIDOXSYN-PWY, pyridoxal 5'-phosphate biosynthesis I: PYRIDOXSYN-PWY
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10330&oldid=16220"