Difference between revisions of "FLAVONADPREDUCT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Gene == Gene Ec-02_001170 == * left end position: ** 1464517 * transcription direction: ** POSITIVE * right end position: ** 1471551 * centisome position: ** 22.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_001170 == |
− | * | + | * left end position: |
− | ** | + | ** 1464517 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1471551 |
− | * | + | * centisome position: |
− | ** | + | ** 22.43511 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0040_0008 | ||
+ | ** Esi0040_0008 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[4.2.2.10-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-14897]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1464517}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1471551}} | |
− | + | {{#set: centisome position=22.43511 }} | |
− | + | {{#set: common name=Esi_0040_0008|Esi0040_0008}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:11, 21 March 2018
Gene Ec-02_001170
- left end position:
- 1464517
- transcription direction:
- POSITIVE
- right end position:
- 1471551
- centisome position:
- 22.43511
- Synonym(s):
- Esi_0040_0008
- Esi0040_0008
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome