Difference between revisions of "ISOVALERYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * inchi k...") |
(Created page with "Category:Gene == Gene Ec-28_000170 == * left end position: ** 219122 * transcription direction: ** POSITIVE * right end position: ** 247073 * centisome position: ** 5.7830...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_000170 == |
− | * | + | * left end position: |
− | ** | + | ** 219122 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 247073 |
− | * | + | * centisome position: |
− | ** | + | ** 5.7830787 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0120_0036 |
+ | ** Esi0120_0036 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[INORGPYROPHOSPHAT-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=219122}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=247073}} | |
− | + | {{#set: centisome position=5.7830787 }} | |
− | + | {{#set: common name=Esi_0120_0036|Esi0120_0036}} | |
− | + | {{#set: reaction associated=INORGPYROPHOSPHAT-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:11, 21 March 2018
Gene Ec-28_000170
- left end position:
- 219122
- transcription direction:
- POSITIVE
- right end position:
- 247073
- centisome position:
- 5.7830787
- Synonym(s):
- Esi_0120_0036
- Esi0120_0036
Reactions associated
- Reaction: INORGPYROPHOSPHAT-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome