Difference between revisions of "Ec-18 000790"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-157 RXN1G-157] == * direction: ** REVERSIBLE * common name: ** 3-oxo-behenoyl-[acyl-carrier p...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-157 RXN1G-157] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
+
 
* common name:
 
* common name:
−
** 5α-cholesta-8,24-dien-3-one
+
** 3-oxo-behenoyl-[acyl-carrier protein] reductase
−
* molecular weight:
+
** NAD(P)-binding domain
−
** 382.628   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-318]]
+
** 1 [[R-3-hydroxybehenoyl-ACPs]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[3-oxo-behenoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxybehenoyl-[acp][c] '''+''' 1 NADP+[c] '''<=>''' 1 a 3-oxo-behenoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_007100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
+
{{#set: common name=3-oxo-behenoyl-[acyl-carrier protein] reductase}}
−
* CHEBI:
+
{{#set: common name=NAD(P)-binding domain}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
+
{{#set: ec number=EC-1.1.1.100}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: gene associated=Ec-01_007100}}
−
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
+
{{#set: in pathway=}}
−
{{#set: common name=5&alpha;-cholesta-8,24-dien-3-one}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=382.628    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN66-318}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:11, 21 March 2018

Reaction RXN1G-157

  • direction:
    • REVERSIBLE
  • common name:
    • 3-oxo-behenoyl-[acyl-carrier protein] reductase
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"3-oxo-behenoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_000790&oldid=16385"