Difference between revisions of "Ec-14 004210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5861 RXN-5861] == * direction: ** LEFT-TO-RIGHT * common name: ** Uncharacterised domain, di-co...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5861 RXN-5861] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC[N+]CCCCC[N+])[N+]
 +
* inchi key:
 +
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
 
* common name:
 
* common name:
−
** Uncharacterised domain, di-copper centre
+
** aminopropylcadaverine
−
** Tyrosinase
+
* molecular weight:
 +
** 162.298   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-3-aminopropyl-1,5-diaminopentane
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[TYR]][c] '''=>''' 2 [[L-DIHYDROXY-PHENYLALANINE]][c]
+
* [[RXN0-5217]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 2 L-tyrosine[c] '''=>''' 2 L-dopa[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-03_003140]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-12_008160]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6133]], (S)-reticuline biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6133 PWY-6133]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6955]], lincomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6955 PWY-6955]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-3581]], (S)-reticuline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3581 PWY-3581]
+
−
** '''3''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-5399]], betacyanin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5399 PWY-5399]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34283 34283]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00731 R00731]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00031 R00031]
+
* LIGAND-CPD:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
−
{{#set: common name=Uncharacterised domain, di-copper centre}}
+
* HMDB : HMDB12189
−
{{#set: common name=Tyrosinase}}
+
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
−
{{#set: gene associated=Ec-03_003140|Ec-12_008160}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
−
{{#set: in pathway=PWY-6133|PWY-6955|PWY-3581|PWY-5399}}
+
{{#set: common name=aminopropylcadaverine}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=162.298    }}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN0-5217}}

Revision as of 14:11, 21 March 2018

Metabolite CPD0-1065

  • smiles:
    • C(CC[N+]CCCCC[N+])[N+]
  • inchi key:
    • InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
  • common name:
    • aminopropylcadaverine
  • molecular weight:
    • 162.298
  • Synonym(s):
    • N-3-aminopropyl-1,5-diaminopentane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_004210&oldid=16419"