Difference between revisions of "DNA-Holder"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_005870 == * left end position: ** 5622408 * transcription direction: ** POSITIVE * right end position: ** 5634963 * centisome position: ** 83.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == |
− | * | + | * smiles: |
− | ** | + | ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J |
− | * | + | * common name: |
− | ** | + | ** tetrahydropteroyl tri-L-glutamate |
− | * | + | * molecular weight: |
− | ** | + | ** 699.633 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** H4PteGlu3 |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12730]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[HOMOCYSMET-RXN]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144] | ||
+ | * HMDB : HMDB12290 | ||
+ | {{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}} | ||
+ | {{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}} | ||
+ | {{#set: common name=tetrahydropteroyl tri-L-glutamate}} | ||
+ | {{#set: molecular weight=699.633 }} | ||
+ | {{#set: common name=H4PteGlu3}} | ||
+ | {{#set: produced by=RXN-12730}} | ||
+ | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} |
Revision as of 13:12, 21 March 2018
Contents
Metabolite CPD-1301
- smiles:
- C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
- inchi key:
- InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
- common name:
- tetrahydropteroyl tri-L-glutamate
- molecular weight:
- 699.633
- Synonym(s):
- H4PteGlu3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)" cannot be used as a page name in this wiki.