Difference between revisions of "TRPSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a dodecanoyl-[acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a dodecanoyl-[acyl-carrier protein] |
− | ** | + | ** a lauryl-[acp] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9535]] | ||
+ | * [[RXN-9653]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9661]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a dodecanoyl-[acp]}} | |
− | + | {{#set: common name=a dodecanoyl-[acyl-carrier protein]|a lauryl-[acp]}} | |
− | + | {{#set: consumed by=RXN-9535|RXN-9653}} | |
− | + | {{#set: produced by=RXN-9661}} | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:12, 21 March 2018
Contents
Metabolite Dodecanoyl-ACPs
- common name:
- a dodecanoyl-[acp]
- Synonym(s):
- a dodecanoyl-[acyl-carrier protein]
- a lauryl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a dodecanoyl-[acp" cannot be used as a page name in this wiki.
- "a dodecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "a lauryl-[acp" cannot be used as a page name in this wiki.