Difference between revisions of "Ec-09 004570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10661 RXN-10661] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogena...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10661 RXN-10661] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
+
 
* common name:
 
* common name:
−
** torulene
+
** Glucose/ribitol dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 534.867   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 3',4'-didehydro-β,ψ-carotene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11989]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Trans-D3-cis-D9-hexadecenoyl-ACPs]][c] '''=>''' 1 [[Palmitoleoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-Δ3-cis-Δ9-hexadecenoyl-[acp][c] '''=>''' 1 a palmitoleoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186]
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678]
+
{{#set: gene associated=Ec-27_002470}}
−
* CHEBI:
+
{{#set: in pathway=PWY-6282}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638]
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613]
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}}
+
−
{{#set: common name=torulene}}
+
−
{{#set: molecular weight=534.867    }}
+
−
{{#set: common name=3',4'-didehydro-β,ψ-carotene}}
+
−
{{#set: consumed by=RXN-11989}}
+

Revision as of 13:12, 21 March 2018

Reaction RXN-10661

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_004570&oldid=16547"