Difference between revisions of "Ec-19 002210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9532 RXN-9532] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-dodecanoyl-[acyl-carrie...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9532 RXN-9532] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
 
* common name:
 
* common name:
−
** 3-oxo-dodecanoyl-[acyl-carrier protein] reductase
+
** β-L-fucose 1-phosphate
−
** NAD(P)-binding domain
+
* molecular weight:
−
* ec number:
+
** 242.122   
−
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
+
−
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
+
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-Fucose 1-phosphate
 +
** 6-deoxy-L-galactose 1-phosphate
 +
** L-fucopyranose 1-(dihydrogen phosphate)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[2.7.7.30-RXN]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-oxo-dodecanoyl-ACPs]][c] '''=>''' 1 [[R-3-hydroxydodecanoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[FUCOKINASE-RXN]]
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-dodecanoyl-[acp][c] '''=>''' 1 a (3R)-3-hydroxydodecanoyl-[acp][c] '''+''' 1 NADP+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_007100]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''28''' reactions found over '''31''' reactions in the full pathway
+
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
+
−
** '''20''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-dodecanoyl-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535]
−
{{#set: common name=NAD(P)-binding domain}}
+
* CHEBI:
−
{{#set: ec number=EC-2.3.1.86}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268]
−
{{#set: ec number=EC-2.3.1.85}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.1.1.100}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985]
−
{{#set: gene associated=Ec-01_007100}}
+
* HMDB : HMDB01265
−
{{#set: in pathway=PWY-5971|PWY-5994}}
+
{{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=β-L-fucose 1-phosphate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=242.122    }}
 +
{{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}}
 +
{{#set: consumed by=2.7.7.30-RXN}}
 +
{{#set: produced by=FUCOKINASE-RXN}}

Revision as of 13:12, 21 March 2018

Metabolite CPD-488

  • smiles:
    • CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
  • common name:
    • β-L-fucose 1-phosphate
  • molecular weight:
    • 242.122
  • Synonym(s):
    • L-Fucose 1-phosphate
    • 6-deoxy-L-galactose 1-phosphate
    • L-fucopyranose 1-(dihydrogen phosphate)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_002210&oldid=16548"