Difference between revisions of "Ec-07 005240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * smiles: ** C([O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(=CC1(=CC=C(O)C=C1))CO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4-coumaryl alcohol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.177 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** p-coumaryl alcohol |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-1102]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646] |
− | {{#set: smiles=C( | + | * HMDB : HMDB03654 |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=4-coumaryl alcohol}} |
− | {{#set: common name= | + | {{#set: molecular weight=150.177 }} |
− | {{#set: | + | {{#set: common name=p-coumaryl alcohol}} |
+ | {{#set: produced by=RXN-1102}} |
Revision as of 13:12, 21 March 2018
Contents
Metabolite COUMARYL-ALCOHOL
- smiles:
- C(=CC1(=CC=C(O)C=C1))CO
- inchi key:
- InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
- common name:
- 4-coumaryl alcohol
- molecular weight:
- 150.177
- Synonym(s):
- p-coumaryl alcohol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links