Difference between revisions of "1.2.1.31-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-Jasmonates Methyl-Jasmonates] == * common name: ** a methyl jasmonate * Synonym(s): ** a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * smiles: ** C1(N=CC=NC=1C(=O)N) * inchi key: ** InChIKey=IPEHBUM...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-Jasmonates Methyl-Jasmonates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
 +
* smiles:
 +
** C1(N=CC=NC=1C(=O)N)
 +
* inchi key:
 +
** InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** a methyl jasmonate
+
** pyrazinamide
 +
* molecular weight:
 +
** 123.114   
 
* Synonym(s):
 
* Synonym(s):
−
** a jasmonic acid methyl ester
+
** pyrazinecarboxamide
−
** a jasmonate methyl ester
+
** pyrazinoic acid amide
−
** an MeJA
+
** pyrazine carboxylamide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10767]]
+
* [[PYRAZIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a methyl jasmonate}}
+
* NCI:
−
{{#set: common name=a jasmonic acid methyl ester|a jasmonate methyl ester|an MeJA}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=14911 14911]
−
{{#set: consumed by=RXN-10767}}
+
* DRUGBANK : DB00339
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1046 1046]
 +
* HMDB : HMDB14483
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01956 C01956]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.1017.html 1017]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45285 45285]
 +
{{#set: smiles=C1(N=CC=NC=1C(=O)N)}}
 +
{{#set: inchi key=InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N}}
 +
{{#set: common name=pyrazinamide}}
 +
{{#set: molecular weight=123.114    }}
 +
{{#set: common name=pyrazinecarboxamide|pyrazinoic acid amide|pyrazine carboxylamide}}
 +
{{#set: consumed by=PYRAZIN-RXN}}

Revision as of 13:13, 21 March 2018

Metabolite PYRAZINAMIDE

  • smiles:
    • C1(N=CC=NC=1C(=O)N)
  • inchi key:
    • InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
  • common name:
    • pyrazinamide
  • molecular weight:
    • 123.114
  • Synonym(s):
    • pyrazinecarboxamide
    • pyrazinoic acid amide
    • pyrazine carboxylamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=1.2.1.31-RXN&oldid=16672"