Difference between revisions of "Ec-12 006930"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...")
(Created page with "Category:Gene == Gene Ec-26_000800 == * left end position: ** 1244196 * transcription direction: ** NEGATIVE * right end position: ** 1252755 * centisome position: ** 18.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Gene Ec-26_000800 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C(O)C(O)C(O)CCl
+
** 1244196
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-chloro-5-deoxy-D-ribonate
+
** 1252755
−
* molecular weight:
+
* centisome position:
−
** 183.568    
+
** 18.899137    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0137_0084
 +
** Esi0137_0084
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11717]]
+
* Reaction: [[2.5.1.19-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-6163]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1244196}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
+
{{#set: right end position=1252755}}
−
{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
+
{{#set: centisome position=18.899137    }}
−
{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
+
{{#set: common name=Esi_0137_0084|Esi0137_0084}}
−
{{#set: molecular weight=183.568    }}
+
{{#set: reaction associated=2.5.1.19-RXN}}
−
{{#set: consumed by=RXN-11717}}
+
{{#set: pathway associated=PWY-6163}}

Revision as of 13:13, 21 March 2018

Gene Ec-26_000800

  • left end position:
    • 1244196
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1252755
  • centisome position:
    • 18.899137
  • Synonym(s):
    • Esi_0137_0084
    • Esi0137_0084

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_006930&oldid=16692"