Difference between revisions of "PWY-7102"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-28_002290 == * left end position: ** 2087744 * transcription direction: ** POSITIVE * right end position: ** 2102768 * centisome position: ** 55.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
+
== Gene Ec-28_002290 ==
−
* smiles:
+
* left end position:
−
** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
+
** 2087744
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-prenylphlorisovalerophenone
+
** 2102768
−
* molecular weight:
+
* centisome position:
−
** 277.339    
+
** 55.09984    
 
* Synonym(s):
 
* Synonym(s):
−
** PPIVP
+
** Esi_0033_0113
−
** compound-X
+
** Esi0033_0113
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7810]]
+
* Reaction: [[2.7.10.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7811]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2087744}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}}
+
{{#set: right end position=2102768}}
−
{{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}}
+
{{#set: centisome position=55.09984   }}
−
{{#set: common name=4-prenylphlorisovalerophenone}}
+
{{#set: common name=Esi_0033_0113|Esi0033_0113}}
−
{{#set: molecular weight=277.339   }}
+
{{#set: reaction associated=2.7.10.1-RXN|PROTEIN-KINASE-RXN}}
−
{{#set: common name=PPIVP|compound-X}}
+
−
{{#set: consumed by=RXN-7810}}
+
−
{{#set: produced by=RXN-7811}}
+

Revision as of 13:13, 21 March 2018

Gene Ec-28_002290

  • left end position:
    • 2087744
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2102768
  • centisome position:
    • 55.09984
  • Synonym(s):
    • Esi_0033_0113
    • Esi0033_0113

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7102&oldid=16717"