Difference between revisions of "GLYCINE-SYN2-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
(Created page with "Category:Gene == Gene Ec-12_006930 == * left end position: ** 6250547 * transcription direction: ** NEGATIVE * right end position: ** 6261447 * centisome position: ** 74.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Gene Ec-12_006930 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 6250547
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 14-oxolanosterol
+
** 6261447
−
* molecular weight:
+
* centisome position:
−
** 440.708    
+
** 74.9821    
 
* Synonym(s):
 
* Synonym(s):
−
** 14-oxo-lanosterol
+
** Esi_0226_0025
−
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
+
** Esi0226_0025
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-305]]
+
* Reaction: [[LYSOPHOSPHOLIPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-304]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-15035]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6250547}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203567 25203567]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: right end position=6261447}}
−
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: centisome position=74.9821   }}
−
{{#set: common name=14-oxolanosterol}}
+
{{#set: common name=Esi_0226_0025|Esi0226_0025}}
−
{{#set: molecular weight=440.708   }}
+
{{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
−
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: pathway associated=PWY-7409}}
−
{{#set: consumed by=RXN66-305}}
+
−
{{#set: produced by=RXN66-304}}
+

Revision as of 13:13, 21 March 2018

Gene Ec-12_006930

  • left end position:
    • 6250547
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6261447
  • centisome position:
    • 74.9821
  • Synonym(s):
    • Esi_0226_0025
    • Esi0226_0025

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLYCINE-SYN2-PWY&oldid=16749"