Difference between revisions of "Arachidoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGLUCEPIM-RXN UDPGLUCEPIM-RXN] == * direction: ** REVERSIBLE * common name: ** UDP-glucose 4-epim...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGLUCEPIM-RXN UDPGLUCEPIM-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-glucose 4-epimerase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.1.3.2 EC-5.1.3.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12575]][c] '''<=>''' 1 [[CPD-14553]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 UDP-α-D-glucose[c] '''<=>''' 1 UDP-α-D-galactose[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | == | + | * Gene: [[Ec-04_000280]] |
− | * [[ | + | ** Source: [[orthology-aragem]] |
+ | * Gene: [[Ec-04_004180]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-05_006710]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7344]], UDP-D-galactose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7344 PWY-7344] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[PWY-6397]], mycolyl-arabinogalactan-peptidoglycan complex biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6397 PWY-6397] | ||
+ | ** '''1''' reactions found over '''17''' reactions in the full pathway | ||
+ | * [[COLANSYN-PWY]], colanic acid building blocks biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=COLANSYN-PWY COLANSYN-PWY] | ||
+ | ** '''6''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-7328]], superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7328 PWY-7328] | ||
+ | ** '''4''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-3821]], D-galactose degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3821 PWY-3821] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22168 22168] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00291 R00291] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P35673 P35673] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P22715 P22715] |
− | * | + | ** [http://www.uniprot.org/uniprot/P21977 P21977] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P24325 P24325] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CE66 Q9CE66] |
− | + | ** [http://www.uniprot.org/uniprot/Q57664 Q57664] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P55180 P55180] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9PNG3 Q9PNG3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P56997 P56997] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q59083 Q59083] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44016 Q44016] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q45291 Q45291] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P96995 P96995] |
+ | ** [http://www.uniprot.org/uniprot/P45602 P45602] | ||
+ | ** [http://www.uniprot.org/uniprot/P18645 P18645] | ||
+ | ** [http://www.uniprot.org/uniprot/P26503 P26503] | ||
+ | ** [http://www.uniprot.org/uniprot/P40801 P40801] | ||
+ | ** [http://www.uniprot.org/uniprot/Q05026 Q05026] | ||
+ | ** [http://www.uniprot.org/uniprot/P56985 P56985] | ||
+ | ** [http://www.uniprot.org/uniprot/Q51148 Q51148] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56093 Q56093] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42605 Q42605] | ||
+ | ** [http://www.uniprot.org/uniprot/Q60109 Q60109] | ||
+ | ** [http://www.uniprot.org/uniprot/P72903 P72903] | ||
+ | ** [http://www.uniprot.org/uniprot/P72915 P72915] | ||
+ | ** [http://www.uniprot.org/uniprot/O66256 O66256] | ||
+ | ** [http://www.uniprot.org/uniprot/O64749 O64749] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9SN58 Q9SN58] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8VZ26 Q8VZ26] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43070 Q43070] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9T0A7 Q9T0A7] | ||
+ | ** [http://www.uniprot.org/uniprot/O65780 O65780] | ||
+ | ** [http://www.uniprot.org/uniprot/O65781 O65781] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9RMC0 Q9RMC0] | ||
+ | ** [http://www.uniprot.org/uniprot/P04397 P04397] | ||
+ | ** [http://www.uniprot.org/uniprot/P09147 P09147] | ||
+ | ** [http://www.uniprot.org/uniprot/P13226 P13226] | ||
+ | ** [http://www.uniprot.org/uniprot/P09609 P09609] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=UDP-glucose 4-epimerase}} | ||
+ | {{#set: ec number=EC-5.1.3.2}} | ||
+ | {{#set: gene associated=Ec-04_000280|Ec-04_004180|Ec-05_006710}} | ||
+ | {{#set: in pathway=PWY-7344|PWY-6397|COLANSYN-PWY|PWY-6527|PWY-7328|PWY-6317|PWY66-422|PWY-3821}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:13, 21 March 2018
Contents
Reaction UDPGLUCEPIM-RXN
- direction:
- REVERSIBLE
- common name:
- UDP-glucose 4-epimerase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 UDP-α-D-glucose[c] <=> 1 UDP-α-D-galactose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-04_000280
- Source: orthology-aragem
- Gene: Ec-04_004180
- Source: orthology-aragem
- Gene: Ec-05_006710
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7344, UDP-D-galactose biosynthesis: PWY-7344
- 1 reactions found over 1 reactions in the full pathway
- PWY-6397, mycolyl-arabinogalactan-peptidoglycan complex biosynthesis: PWY-6397
- 1 reactions found over 17 reactions in the full pathway
- COLANSYN-PWY, colanic acid building blocks biosynthesis: COLANSYN-PWY
- 6 reactions found over 11 reactions in the full pathway
- PWY-6527, stachyose degradation: PWY-6527
- 5 reactions found over 7 reactions in the full pathway
- PWY-7328, superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis: PWY-7328
- 4 reactions found over 10 reactions in the full pathway
- PWY-6317, D-galactose degradation I (Leloir pathway): PWY-6317
- 5 reactions found over 5 reactions in the full pathway
- PWY66-422, D-galactose degradation V (Leloir pathway): PWY66-422
- 5 reactions found over 5 reactions in the full pathway
- PWY-3821, D-galactose degradation III: PWY-3821
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: