Difference between revisions of "PWY-5130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** L-Nδ-acetylornithine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-N-delta-acetylornithine biosynthesis |
− | ** & | + | ** Nδ-acetyl-L-ornithine biosynthesis |
− | + | ** L-N5-acetylornithine biosynthesis | |
− | ** | + | |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[2- | + | '''6''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[ARGINASE-RXN]] | |
− | == Reaction(s) | + | ** 2 associated gene(s): |
− | * [ | + | *** [[Ec-10_001100]] |
+ | *** [[Ec-22_003700]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTKIN-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-27_003730]] | ||
+ | *** [[Ec-24_000610]] | ||
+ | *** [[Ec-07_007490]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-07_007490]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-21_003730]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-14903]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-18_001350]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[SPONTPRO-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12667 RXN-12667] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-6922 |
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-6922 PWY-6922] |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=L-Nδ-acetylornithine biosynthesis}} | |
− | + | {{#set: common name=L-N-delta-acetylornithine biosynthesis|Nδ-acetyl-L-ornithine biosynthesis|L-N5-acetylornithine biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=86.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:13, 21 March 2018
Pathway PWY-6922
- taxonomic range:
- common name:
- L-Nδ-acetylornithine biosynthesis
- Synonym(s):
- L-N-delta-acetylornithine biosynthesis
- Nδ-acetyl-L-ornithine biosynthesis
- L-N5-acetylornithine biosynthesis
Reaction(s) found
6 reactions found over 7 reactions in the full pathway
- ARGINASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTKIN-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTSEMIALDEHYDROG-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14903
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- SPONTPRO-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- PLANTCYC : PWY-6922
- ARACYC: