Difference between revisions of "THREDEHYD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == |
* smiles: | * smiles: | ||
| − | ** CC(C( | + | ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K |
* common name: | * common name: | ||
| − | ** | + | ** FAD |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 782.533 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** flavin adenine dinucleotide oxidized |
| − | ** | + | ** flavin adenine dinucleotide |
| − | ** | + | ** flavitan |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[MEPROPCOA-FAD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FADSYN-RXN]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-14264]] |
== External links == | == External links == | ||
| + | * CAS : 146-14-5 | ||
| + | * Wikipedia : Flavin_adenine_dinucleotide | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035] | ||
| + | * HMDB : HMDB01248 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692] |
| − | * BIGG : | + | * BIGG : 33521 |
| − | + | {{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}} | |
| − | + | {{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}} | |
| − | + | {{#set: common name=FAD}} | |
| − | {{#set: smiles=CC(C( | + | {{#set: molecular weight=782.533 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}} |
| − | {{#set: common name= | + | {{#set: consumed by=MEPROPCOA-FAD-RXN}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=FADSYN-RXN}} |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-14264}} |
| − | {{#set: produced by= | + | |
| − | {{#set: reversible reaction associated= | + | |
Revision as of 14:14, 21 March 2018
Contents
Metabolite FAD
- smiles:
- CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
- inchi key:
- InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
- common name:
- FAD
- molecular weight:
- 782.533
- Synonym(s):
- flavin adenine dinucleotide oxidized
- flavin adenine dinucleotide
- flavitan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 146-14-5
- Wikipedia : Flavin_adenine_dinucleotide
- PUBCHEM:
- HMDB : HMDB01248
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 33521
"CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))" cannot be used as a page name in this wiki.
