Difference between revisions of "RXN-5469"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Gene == Gene Ec-05_005740 == * left end position: ** 7667231 * transcription direction: ** NEGATIVE * right end position: ** 7671055 * centisome position: ** 84.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_005740 == |
− | * | + | * left end position: |
− | ** | + | ** 7667231 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7671055 |
− | * | + | * centisome position: |
− | ** | + | ** 84.222855 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0143_0043 |
− | ** | + | ** Esi0143_0043 |
− | ** | + | ** NDA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[RXN0-5330]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-6692]] |
− | * [[ | + | * [[PWY-3781]] |
− | * [[ | + | * [[PWY-7269]] |
− | * [[ | + | * [[PWY-7279]] |
− | * [[ | + | * [[PWY0-1567]] |
− | * [[ | + | * [[PWY-5083]] |
− | * [[ | + | * [[PWY0-1335]] |
+ | * [[PWY0-1334]] | ||
+ | * [[PWY0-1568]] | ||
+ | * [[PWY-4302]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7667231}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7671055}} | |
− | + | {{#set: centisome position=84.222855 }} | |
− | + | {{#set: common name=Esi_0143_0043|Esi0143_0043|NDA}} | |
− | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN|RXN0-5330}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-3781|PWY-7269|PWY-7279|PWY0-1567|PWY-5083|PWY0-1335|PWY0-1334|PWY0-1568|PWY-4302}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:14, 21 March 2018
Gene Ec-05_005740
- left end position:
- 7667231
- transcription direction:
- NEGATIVE
- right end position:
- 7671055
- centisome position:
- 84.222855
- Synonym(s):
- Esi_0143_0043
- Esi0143_0043
- NDA
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN0-5330
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome