Difference between revisions of "UROGENIIISYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Gene == Gene Ec-18_001620 == * left end position: ** 1601107 * transcription direction: ** NEGATIVE * right end position: ** 1606501 * centisome position: ** 32.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Gene Ec-18_001620 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 1601107
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 8-oxo-GTP
+
** 1606501
−
* molecular weight:
+
* centisome position:
−
** 535.151    
+
** 32.49951    
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-guanosine-triphosphate
+
** Esi_0199_0025
 +
** Esi0199_0025
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
−
* [[RXN-11409]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1601107}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: right end position=1606501}}
−
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: centisome position=32.49951   }}
−
{{#set: common name=8-oxo-GTP}}
+
{{#set: common name=Esi_0199_0025|Esi0199_0025}}
−
{{#set: molecular weight=535.151   }}
+
{{#set: reaction associated=THIOPURINE-S-METHYLTRANSFERASE-RXN}}
−
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
−
{{#set: produced by=RXN-11409}}
+

Revision as of 14:14, 21 March 2018

Gene Ec-18_001620

  • left end position:
    • 1601107
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1606501
  • centisome position:
    • 32.49951
  • Synonym(s):
    • Esi_0199_0025
    • Esi0199_0025

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=UROGENIIISYN-RXN&oldid=16840"