Difference between revisions of "PWY-6405"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_005420 == * left end position: ** 5261480 * transcription direction: ** NEGATIVE * right end position: ** 5268410 * centisome position: ** 68.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17323 CPD-17323] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17323 CPD-17323] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LVXQCHCSSLFKLO-KPOVBLHLSA-J |
| − | * | + | * common name: |
| − | ** | + | ** adrenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1078.012 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA |
| − | ** | + | ** (7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16081]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-16114]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581112 71581112] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73856 73856] |
| − | {{#set: common name= | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LVXQCHCSSLFKLO-KPOVBLHLSA-J}} |
| + | {{#set: common name=adrenoyl-CoA}} | ||
| + | {{#set: molecular weight=1078.012 }} | ||
| + | {{#set: common name=(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-16081}} | ||
| + | {{#set: produced by=RXN-16114}} | ||
Revision as of 13:14, 21 March 2018
Contents
Metabolite CPD-17323
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=LVXQCHCSSLFKLO-KPOVBLHLSA-J
- common name:
- adrenoyl-CoA
- molecular weight:
- 1078.012
- Synonym(s):
- (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
- (7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
