Difference between revisions of "ACETATE--COA-LIGASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
+
** [http://enzyme.expasy.org/EC/3.5.5.1 EC-3.5.5.1]
−
* common name:
+
−
** D-myo-inositol (1,3,4)-trisphosphate
+
−
* molecular weight:
+
−
** 414.049   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4)P3
 
−
** 1-D-myo-inositol (1,3,4)-trisphosphate
 
−
** inositol 1,3,4-trisphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.7.1.139-RXN]]
+
* With identifiers:
−
* [[RXN-10939]]
+
** 1 [[INDOLEYL-CPD]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
−
* [[2.7.1.133-RXN]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 indole-3-acetonitrile[c] '''+''' 2 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 indole-3-acetate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_002370]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-26_000350]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
 +
** '''2''' reactions found over '''14''' reactions in the full pathway
 +
* [[PWY-5026]], indole-3-acetate biosynthesis V (bacteria and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
* [[PWYQT-4476]], indole glucosinolate breakdown (insect chewing induced): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476]
 +
** '''1''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03093 R03093]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414]
+
{{#set: ec number=EC-3.5.5.1}}
−
* METABOLIGHTS : MTBLC58414
+
{{#set: gene associated=Ec-01_002370|Ec-26_000350}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-581|PWY-5026|PWYQT-4476}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB01143
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}}
+
−
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}}
+
−
{{#set: molecular weight=414.049    }}
+
−
{{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}}
+
−
{{#set: consumed by=2.7.1.139-RXN|RXN-10939|2.7.1.133-RXN}}
+

Revision as of 14:16, 21 March 2018

Reaction RXN-1404

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-581, indole-3-acetate biosynthesis II: PWY-581
    • 2 reactions found over 14 reactions in the full pathway
  • PWY-5026, indole-3-acetate biosynthesis V (bacteria and fungi): PWY-5026
    • 1 reactions found over 1 reactions in the full pathway
  • PWYQT-4476, indole glucosinolate breakdown (insect chewing induced): PWYQT-4476
    • 1 reactions found over 14 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ACETATE--COA-LIGASE-RXN&oldid=17228"