Difference between revisions of "PWY-4061"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Gene == Gene Ec-12_004580 == * left end position: ** 4264212 * transcription direction: ** POSITIVE * right end position: ** 4270019 * centisome position: ** 51.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] ==
+
== Gene Ec-12_004580 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4264212
−
* common name:
+
* transcription direction:
−
** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* right end position:
−
** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
+
** 4270019
−
* molecular weight:
+
* centisome position:
−
** 1051.975    
+
** 51.15386    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0070_0069
 +
** Esi0070_0069
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16097]]
+
* Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16096]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4264212}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4270019}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409]
+
{{#set: centisome position=51.15386   }}
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0070_0069|Esi0070_0069}}
−
{{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}}
+
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}}
+
−
{{#set: molecular weight=1051.975   }}
+
−
{{#set: consumed by=RXN-16097}}
+
−
{{#set: produced by=RXN-16096}}
+

Revision as of 13:18, 21 March 2018

Gene Ec-12_004580

  • left end position:
    • 4264212
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4270019
  • centisome position:
    • 51.15386
  • Synonym(s):
    • Esi_0070_0069
    • Esi0070_0069

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-4061&oldid=17435"