Difference between revisions of "RXN-5581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-20_001540 == * left end position: ** 1547296 * transcription direction: ** POSITIVE * right end position: ** 1558640 * centisome position: ** 30.0...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+
== Gene Ec-20_001540 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1547296
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 6-trans-tridecenoyl-CoA
+
** 1558640
−
* molecular weight:
+
* centisome position:
−
** 957.819    
+
** 30.007168    
 
* Synonym(s):
 
* Synonym(s):
−
** 6E-tridecenoyl-CoA
+
** Esi_0023_0031
 +
** Esi0023_0031
 +
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14785]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1547296}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=1558640}}
−
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
+
{{#set: centisome position=30.007168   }}
−
{{#set: common name=6-trans-tridecenoyl-CoA}}
+
{{#set: common name=Esi_0023_0031|Esi0023_0031|PK}}
−
{{#set: molecular weight=957.819   }}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=6E-tridecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-14785}}
+

Revision as of 13:19, 21 March 2018

Gene Ec-20_001540

  • left end position:
    • 1547296
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1558640
  • centisome position:
    • 30.007168
  • Synonym(s):
    • Esi_0023_0031
    • Esi0023_0031
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-5581&oldid=17589"