Difference between revisions of "CPD-5168"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] ==
−
* smiles:
+
* taxonomic range:
−
** C1(NC=NC=1CC([CH]=O)[N+])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
−
** histidinal
+
** 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)
−
* molecular weight:
+
−
** 140.164   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-histidinal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[HISTALDEHYD-RXN]]
+
'''3''' reactions found over '''12''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-14785]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
−
* [[HISTOLDEHYD-RXN]]
+
*** [[Ec-22_002920]]
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-14789]]
 +
** 3 associated gene(s):
 +
*** [[Ec-22_002920]]
 +
*** [[Ec-26_004320]]
 +
*** [[Ec-08_006390]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-14790]]
 +
** 1 associated gene(s):
 +
*** [[Ec-16_003950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14777 RXN-14777]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14778 RXN-14778]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14779 RXN-14779]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14780 RXN-14780]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14781 RXN-14781]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14784 RXN-14784]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14786 RXN-14786]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14787 RXN-14787]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14788 RXN-14788]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283]
+
{{#set: common name=10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)}}
−
* CHEBI:
+
{{#set: reaction found=3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802]
+
{{#set: total reaction=12}}
−
* LIGAND-CPD:
+
{{#set: completion rate=25.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929]
+
−
* HMDB : HMDB12234
+
−
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}}
+
−
{{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}}
+
−
{{#set: common name=histidinal}}
+
−
{{#set: molecular weight=140.164    }}
+
−
{{#set: common name=L-histidinal}}
+
−
{{#set: consumed by=HISTALDEHYD-RXN}}
+
−
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}
+

Revision as of 13:20, 21 March 2018

Pathway PWY-7338

  • taxonomic range:
  • common name:
    • 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast)
  • Synonym(s):

Reaction(s) found

3 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-5168&oldid=17767"