Difference between revisions of "Aliphatic-Amines"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_004550 == * left end position: ** 4604405 * transcription direction: ** POSITIVE * right end position: ** 4609303 * centisome position: ** 93.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 296.358 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP |
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-15684]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891] |
| − | {{#set: | + | {{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}} |
| − | + | {{#set: molecular weight=296.358 }} | |
| − | {{#set: | + | {{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}} |
| + | {{#set: produced by=RXN-15684}} | ||
Revision as of 13:21, 21 March 2018
Contents
Metabolite CPD-17050
- smiles:
- C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
- inchi key:
- InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
- common name:
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
- molecular weight:
- 296.358
- Synonym(s):
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
