Difference between revisions of "3-oxo-cis-vaccenoyl-ACPs"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_005740 == * Synonym(s): ** Esi_0014_0084 ** Esi0014_0084 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXYPHYTANOYL-COA 2-HYDROXYPHYTANOYL-COA] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXYPHYTANOYL-COA 2-HYDROXYPHYTANOYL-COA] == |
+ | * smiles: | ||
+ | ** CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=WNVFJMYPVBOLKV-YLNUKALLSA-J | ||
+ | * common name: | ||
+ | ** 2-hydroxyphytanoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 1074.021 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.14.11.18-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07343 C07343] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57334 57334] | ||
+ | * METABOLIGHTS : MTBLC57334 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266567 45266567] | ||
+ | * HMDB : HMDB01295 | ||
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=WNVFJMYPVBOLKV-YLNUKALLSA-J}} | ||
+ | {{#set: common name=2-hydroxyphytanoyl-CoA}} | ||
+ | {{#set: molecular weight=1074.021 }} | ||
+ | {{#set: produced by=1.14.11.18-RXN}} |
Revision as of 13:21, 21 March 2018
Contents
Metabolite 2-HYDROXYPHYTANOYL-COA
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=WNVFJMYPVBOLKV-YLNUKALLSA-J
- common name:
- 2-hydroxyphytanoyl-CoA
- molecular weight:
- 1074.021
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.