Difference between revisions of "N-4-aminobutylidene-eIF5A-lysine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** very long chain fatty acid biosynthesis II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cerotate biosynthesis |
− | ** | + | ** hexacosanoate biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''16''' reactions in the full pathway |
− | * [[ | + | * [[RXN-13295]] |
− | + | ** 0 associated gene: | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[RXN- | + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] |
− | * [[ | + | * [[RXN-13299]] |
− | * [[ | + | ** 0 associated gene: |
− | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-13303]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-13307]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13294 RXN-13294] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13296 RXN-13296] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13297 RXN-13297] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13300 RXN-13300] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13301 RXN-13301] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13302 RXN-13302] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13304 RXN-13304] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13305 RXN-13305] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13306 RXN-13306] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13309 RXN-13309] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=very long chain fatty acid biosynthesis II}} | |
− | + | {{#set: common name=cerotate biosynthesis|hexacosanoate biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=16}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:23, 21 March 2018
Pathway PWY-7036
- taxonomic range:
- common name:
- very long chain fatty acid biosynthesis II
- Synonym(s):
- cerotate biosynthesis
- hexacosanoate biosynthesis
Reaction(s) found
4 reactions found over 16 reactions in the full pathway
- RXN-13295
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-13299
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-13303
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-13307
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
- RXN-13294
- RXN-13296
- RXN-13297
- RXN-13298
- RXN-13300
- RXN-13301
- RXN-13302
- RXN-13304
- RXN-13305
- RXN-13306
- RXN-13308
- RXN-13309