Difference between revisions of "PWY-5938"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** GMP synthase (g...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] ==
* smiles:
+
* direction:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
 
* common name:
 
* common name:
** 24-methylenecholesterol
+
** GMP synthase (glutamine-hydrolyzing)
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-707]]
+
** 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[GMP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 ammonium[c] '''+''' 1 XMP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 2 H+[c] '''+''' 1 GMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-13_002710]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18301 18301]
* LIGAND-CPD:
+
* LIGAND-RXN:
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01230 R01230]
* HMDB : HMDB06849
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=GMP synthase (glutamine-hydrolyzing)}}
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: gene associated=Ec-13_002710}}
{{#set: common name=24-methylenecholesterol}}
+
{{#set: in pathway=}}
{{#set: molecular weight=398.671    }}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: produced by=RXN-707}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 14:24, 21 March 2018

Reaction GMP-SYN-NH3-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • GMP synthase (glutamine-hydrolyzing)
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links