Difference between revisions of "CPD-19169"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9230 RXN-9230] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxybenzoate nonaprenylt...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9230 RXN-9230] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 4-hydroxybenzoate nonaprenyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[CPD-9610]][c] '''=>''' 1 [[CPD-9864]][c] '''+''' 1 [[PPI]][c] | |
− | = | + | * With common name(s): |
− | + | ** 1 4-hydroxybenzoate[c] '''+''' 1 all-trans-decaprenyl diphosphate[c] '''=>''' 1 3-decaprenyl-4-hydroxybenzoate[c] '''+''' 1 diphosphate[c] | |
− | + | ||
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-00_007360]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | + | == Pathways == | |
− | * [[ | + | * [[PWY-5872]], ubiquinol-10 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5872 PWY-5872] |
− | == | + | ** '''1''' reactions found over '''9''' reactions in the full pathway |
− | * [[ | + | * [[PWY-5857]], ubiquinol-10 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5857 PWY-5857] |
− | * [[ | + | ** '''1''' reactions found over '''8''' reactions in the full pathway |
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=4-hydroxybenzoate nonaprenyltransferase}} | |
− | + | {{#set: ec number=EC-2.5.1.39}} | |
− | + | {{#set: gene associated=Ec-00_007360}} | |
− | + | {{#set: in pathway=PWY-5872|PWY-5857}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:25, 21 March 2018
Contents
Reaction RXN-9230
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-hydroxybenzoate nonaprenyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-hydroxybenzoate[c] + 1 CPD-9610[c] => 1 CPD-9864[c] + 1 PPI[c]
- With common name(s):
- 1 4-hydroxybenzoate[c] + 1 all-trans-decaprenyl diphosphate[c] => 1 3-decaprenyl-4-hydroxybenzoate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_007360
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5872, ubiquinol-10 biosynthesis (eukaryotic): PWY-5872
- 1 reactions found over 9 reactions in the full pathway
- PWY-5857, ubiquinol-10 biosynthesis (prokaryotic): PWY-5857
- 1 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome