Difference between revisions of "RXN0-5515"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7230 RXN0-7230] == * direction: ** LEFT-TO-RIGHT * common name: ** choline dehydrogenase * ec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7230 RXN0-7230] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** choline dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.99.1 EC-1.1.99.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CHOLINE]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[BETAINE_ALDEHYDE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 choline[c] '''+''' 1 an electron-transfer quinone[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 betaine aldehyde[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
+ | * Gene: [[Ec-00_005920]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=choline dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.1.99.1}} | |
− | + | {{#set: gene associated=Ec-00_005920}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:25, 21 March 2018
Contents
Reaction RXN0-7230
- direction:
- LEFT-TO-RIGHT
- common name:
- choline dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CHOLINE[c] + 1 ETR-Quinones[c] => 1 ETR-Quinols[c] + 1 BETAINE_ALDEHYDE[c]
- With common name(s):
- 1 choline[c] + 1 an electron-transfer quinone[c] => 1 an electron-transfer quinol[c] + 1 betaine aldehyde[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_005920
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome