Difference between revisions of "PWY-1121"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] == * common name: ** a [protein] N-terminal amin...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] ==
* smiles:
+
** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)
+
* inchi key:
+
** InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M
+
 
* common name:
 
* common name:
** (2S)-pinocembrin
+
** a [protein] N-terminal amino acid
* molecular weight:
+
** 255.249   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an N-terminal amino acid-[protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7648]]
+
* [[RXN-15564]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7647]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPK12140214
+
{{#set: common name=a [protein] N-terminal amino acid}}
* PUBCHEM:
+
{{#set: common name=an N-terminal amino acid-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200438 25200438]
+
{{#set: consumed by=RXN-15564}}
* HMDB : HMDB30808
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C09827 C09827]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28157 28157]
+
* METABOLIGHTS : MTBLC28157
+
{{#set: smiles=C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3)}}
+
{{#set: inchi key=InChIKey=URFCJEUYXNAHFI-ZDUSSCGKSA-M}}
+
{{#set: common name=(2S)-pinocembrin}}
+
{{#set: molecular weight=255.249    }}
+
{{#set: consumed by=RXN-7648}}
+
{{#set: produced by=RXN-7647}}
+

Revision as of 14:25, 21 March 2018

Metabolite N-terminal-Amino-Acids

  • common name:
    • a [protein] N-terminal amino acid
  • Synonym(s):
    • an N-terminal amino acid-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein] N-terminal amino acid" cannot be used as a page name in this wiki.
"an N-terminal amino acid-[protein" cannot be used as a page name in this wiki.