Difference between revisions of "PWY-7656"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15268 RXN-15268] == * direction: ** REVERSIBLE * common name: ** Alpha-(1,3)-fucosyltransferase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15268 RXN-15268] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** REVERSIBLE
* inchi key:
+
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** Alpha-(1,3)-fucosyltransferase, family GT10
* molecular weight:
+
* ec number:
** 429.662   
+
** [http://enzyme.expasy.org/EC/2.4.1.152 EC-2.4.1.152]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-23]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[GUANOSINE_DIPHOSPHATE_FUCOSE]][c] '''+''' 1 [[BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE]][c] '''<=>''' 1 [[CPD-16475]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GDP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 GDP-L-fucose[c] '''+''' 1 &beta;-D-galactosyl-1,4-N-acetyl-&beta;-D-glucosamine[c] '''<=>''' 1 &beta;-D-galactosyl-(1&rarr;4)-[&alpha;-L-fucosyl-(1&rarr;3)]-N-acetyl-&beta;-D-glucosamine[c] '''+''' 1 H+[c] '''+''' 1 GDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-03_005030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200717 25200717]
+
{{#set: common name=Alpha-(1,3)-fucosyltransferase, family GT10}}
* HMDB : HMDB12166
+
{{#set: ec number=EC-2.4.1.152}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: gene associated=Ec-03_005030}}
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
{{#set: in pathway=}}
{{#set: common name=4&alpha;-carboxy-5&alpha;-cholesta-8-en-3&beta;-ol}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=429.662    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: consumed by=RXN66-23}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:25, 21 March 2018

Reaction RXN-15268

  • direction:
    • REVERSIBLE
  • common name:
    • Alpha-(1,3)-fucosyltransferase, family GT10
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links