Difference between revisions of "CPD-11519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * smiles: ** C(C1(C(C(C(O1)(COP(=O)([O-])[O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
+
 
* common name:
 
* common name:
−
** fructose 1,6-bisphosphate
+
** stearate biosynthesis II (bacteria and plants)
−
* molecular weight:
+
−
** 336.085   
+
 
* Synonym(s):
 
* Synonym(s):
−
** fructose 1,6-biphosphate
+
** stearic acid biosynthesis
−
** fructose 1,6-diphosphate
+
−
** β-D-fructose 1,6-diphosphate
+
−
** D-fructose 1,6-diphosphate
+
−
** D-fructos 1,6-bisphosphate
+
−
** fructose 1,6-bisphosphate
+
−
** FBP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[F16BDEPHOS-RXN]]
+
'''6''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-16380]]
−
* [[6PFRUCTPHOS-RXN]]
+
** 4 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_001560]]
−
* [[F16ALDOLASE-RXN]]
+
*** [[Ec-02_006430]]
 +
*** [[Ec-12_008720]]
 +
*** [[Ec-03_003710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9548]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9632]]
 +
** 4 associated gene(s):
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-12_000650]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9633]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9634]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9635]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 488-69-7
+
{{#set: taxonomic range=TAX-33090}}
−
* Wikipedia : Fructose_1,6-bisphosphate
+
{{#set: taxonomic range=TAX-2}}
−
* PUBCHEM:
+
{{#set: common name=stearate biosynthesis II (bacteria and plants)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765]
+
{{#set: common name=stearic acid biosynthesis}}
−
* HMDB : HMDB01058
+
{{#set: reaction found=6}}
−
* LIGAND-CPD:
+
{{#set: total reaction=6}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354]
+
{{#set: completion rate=100.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966]
+
−
* BIGG : 34717
+
−
{{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}}
+
−
{{#set: common name=fructose 1,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085    }}
+
−
{{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}}
+
−
{{#set: consumed by=F16BDEPHOS-RXN}}
+
−
{{#set: produced by=6PFRUCTPHOS-RXN}}
+
−
{{#set: reversible reaction associated=F16ALDOLASE-RXN}}
+

Revision as of 14:26, 21 March 2018

Pathway PWY-5989

  • taxonomic range:
  • common name:
    • stearate biosynthesis II (bacteria and plants)
  • Synonym(s):
    • stearic acid biosynthesis

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-11519&oldid=18600"