Difference between revisions of "PWY-3641"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UTP UTP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J |
* common name: | * common name: | ||
| − | ** | + | ** UTP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 480.112 |
* Synonym(s): | * Synonym(s): | ||
| + | ** uridine-triphosphate | ||
| + | ** uridine-5'-triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-724]] |
| + | * [[CTPSYN-RXN]] | ||
| + | * [[RXN-14139]] | ||
| + | * [[NAG1P-URIDYLTRANS-RXN]] | ||
| + | * [[RXN-12199]] | ||
| + | * [[RXN-14325]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[UDPKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GLUC1PURIDYLTRANS-RXN]] | ||
| + | * [[RXN-12196]] | ||
== External links == | == External links == | ||
| + | * CAS : 63-39-8 | ||
| + | * BIGG : 33760 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058168 7058168] |
| − | * HMDB : | + | * HMDB : HMDB00285 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00075 C00075] |
| − | {{#set: common name= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5414500.html 5414500] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46398 46398] | ||
| + | * METABOLIGHTS : MTBLC46398 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
| + | {{#set: inchi key=InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J}} | ||
| + | {{#set: common name=UTP}} | ||
| + | {{#set: molecular weight=480.112 }} | ||
| + | {{#set: common name=uridine-triphosphate|uridine-5'-triphosphate}} | ||
| + | {{#set: consumed by=RXN0-724|CTPSYN-RXN|RXN-14139|NAG1P-URIDYLTRANS-RXN|RXN-12199|RXN-14325}} | ||
| + | {{#set: produced by=UDPKIN-RXN}} | ||
| + | {{#set: reversible reaction associated=GLUC1PURIDYLTRANS-RXN|RXN-12196}} | ||
Revision as of 13:27, 21 March 2018
Contents
Metabolite UTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=PGAVKCOVUIYSFO-XVFCMESISA-J
- common name:
- UTP
- molecular weight:
- 480.112
- Synonym(s):
- uridine-triphosphate
- uridine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 63-39-8
- BIGG : 33760
- PUBCHEM:
- HMDB : HMDB00285
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC46398
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
