Difference between revisions of "PWY-5989"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-lysine biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-lysine and L-diaminopimelate biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''6''' reactions found over '''9''' reactions in the full pathway |
− | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-01_007470]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ASPARTATEKIN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-24_000610]] | ||
+ | *** [[Ec-11_000830]] | ||
+ | *** [[Ec-27_003730]] | ||
+ | *** [[Ec-13_002530]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIAMINOPIMDECARB-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-01_000060]] | ||
+ | *** [[Ec-09_002360]] | ||
+ | *** [[Ec-09_002410]] | ||
+ | *** [[Ec-09_002420]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIAMINOPIMEPIM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-06_009100]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[DIHYDRODIPICSYN-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-14014]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-15_000750]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SUCCDIAMINOPIMDESUCC-RXN SUCCDIAMINOPIMDESUCC-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SUCCINYLDIAMINOPIMTRANS-RXN SUCCINYLDIAMINOPIMTRANS-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TETHYDPICSUCC-RXN TETHYDPICSUCC-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=L-lysine biosynthesis I}} | |
− | + | {{#set: common name=L-lysine and L-diaminopimelate biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:27, 21 March 2018
Pathway DAPLYSINESYN-PWY
- taxonomic range:
- common name:
- L-lysine biosynthesis I
- Synonym(s):
- L-lysine and L-diaminopimelate biosynthesis
Reaction(s) found
6 reactions found over 9 reactions in the full pathway
- ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- ASPARTATEKIN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- DIAMINOPIMDECARB-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- DIAMINOPIMEPIM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- DIHYDRODIPICSYN-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-14014
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: