Difference between revisions of "PWY-3161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-81 PWY-81] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-81 PWY-81] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** toluene degradation to benzoyl-CoA (anaerobic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** toluene oxidation (anaerobic) |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[RXN-902]] |
− | * [[ | + | ** 4 associated gene(s): |
− | + | *** [[Ec-06_001380]] | |
− | * [[ | + | *** [[Ec-16_003560]] |
− | * [[ | + | *** [[Ec-16_001250]] |
− | * [[ | + | *** [[Ec-14_006530]] |
− | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-esiliculosus_genome]] |
− | * [ | + | * [[RXN-905]] |
− | * [ | + | ** 2 associated gene(s): |
− | * [ | + | *** [[Ec-14_006530]] |
+ | *** [[Ec-19_005290]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-863 RXN-863] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-864 RXN-864] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-865 RXN-865] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-904 RXN-904] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : tol2 |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=toluene degradation to benzoyl-CoA (anaerobic)}} | |
− | + | {{#set: common name=toluene oxidation (anaerobic)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:28, 21 March 2018
Pathway PWY-81
- taxonomic range:
- common name:
- toluene degradation to benzoyl-CoA (anaerobic)
- Synonym(s):
- toluene oxidation (anaerobic)
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- RXN-902
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-905
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- UM-BBD-PWY : tol2