Difference between revisions of "Ec-07 003680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Actinorhodin-Intermediate-2 Actinorhodin-Intermediate-2] == * common name: ** a (1',5'-dihydrox...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Actinorhodin-Intermediate-2 Actinorhodin-Intermediate-2] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 2- | + | ** a (1',5'-dihydroxy-3'-oxo-2'-(3''-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate-[PKS-acp] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 2- | + | ** a S-ACP 6-(1',5'-dihydroxy-3'-oxo-2'-(3''-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate |
− | + | ** intermediate 2 | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1A0-6303]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (1',5'-dihydroxy-3'-oxo-2'-(3''-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate-[PKS-acp]}} | |
− | + | {{#set: common name=a S-ACP 6-(1',5'-dihydroxy-3'-oxo-2'-(3''-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate|intermediate 2}} | |
− | + | {{#set: produced by=RXN1A0-6303}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: produced by= | + |
Revision as of 14:28, 21 March 2018
Contents
Metabolite Actinorhodin-Intermediate-2
- common name:
- a (1',5'-dihydroxy-3'-oxo-2'-(3-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate-[PKS-acp]
- Synonym(s):
- a S-ACP 6-(1',5'-dihydroxy-3'-oxo-2'-(3-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate
- intermediate 2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (1',5'-dihydroxy-3'-oxo-2'-(3-oxobutanoyl)cyclohexyl)-3,5-dioxohexanethioate-[PKS-acp" cannot be used as a page name in this wiki.