Difference between revisions of "CPD-11512"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
 +
* inchi key:
 +
** InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
 
* common name:
 
* common name:
−
** β-alanine biosynthesis IV
+
** dihydrozeatin
 +
* molecular weight:
 +
** 221.261   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
 +
** N6-(4-Hydroxyisopentanyl)adenine
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-4726]]
−
* [[RXN-6382]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-11_002450]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9015 RXN-9015]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* CAS : 23599-75-9
−
{{#set: common name=β-alanine biosynthesis IV}}
+
* PUBCHEM:
−
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439631 439631]
−
{{#set: total reaction=2}}
+
* HMDB : HMDB12215
−
{{#set: completion rate=50.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02029 C02029]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.388705.html 388705]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17874 17874]
 +
{{#set: smiles=CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))}}
 +
{{#set: inchi key=InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N}}
 +
{{#set: common name=dihydrozeatin}}
 +
{{#set: molecular weight=221.261    }}
 +
{{#set: common name=2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol|N6-(4-Hydroxyisopentanyl)adenine}}
 +
{{#set: consumed by=RXN-4726}}

Revision as of 14:28, 21 March 2018

Metabolite CPD-332

  • smiles:
    • CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2))
  • inchi key:
    • InChIKey=XXFACTAYGKKOQB-ZETCQYMHSA-N
  • common name:
    • dihydrozeatin
  • molecular weight:
    • 221.261
  • Synonym(s):
    • 2-Methyl-4-(1H-purin-6-ylamino)butan-1-ol
    • N6-(4-Hydroxyisopentanyl)adenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-11512&oldid=18933"