Difference between revisions of "PWY-6470"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12178 RXN-12178] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycosyl hydrolase, family...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12178 RXN-12178] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M
+
 
* common name:
 
* common name:
−
** 3-dehydroshikimate
+
** Glycosyl hydrolase, family 88
−
* molecular weight:
+
* ec number:
−
** 171.129   
+
** [http://enzyme.expasy.org/EC/3.2.1.179 EC-3.2.1.179]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-dehydroshikimic acid
 
−
** 5-dehydroshikimic acid
 
−
** 5-dehydroshikimate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-36]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-13122]][c] '''+''' 1 [[N-acetyl-D-galactosamine]][c]
−
* [[RXN-7968]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine[c] '''+''' 1 H2O[c] '''=>''' 1 4-deoxy-L-threo-hex-4-enopyranuronate[c] '''+''' 1 N-acetyl-D-galactosamine[c]
−
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_002970]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-02_002980]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7646]], dermatan sulfate degradation I (bacterial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7646 PWY-7646]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-6572]], chondroitin sulfate degradation I (bacterial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6572 PWY-6572]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460360 5460360]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31654 31654]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.4573915.html 4573915]
+
{{#set: common name=Glycosyl hydrolase, family 88}}
−
* CHEBI:
+
{{#set: ec number=EC-3.2.1.179}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16630 16630]
+
{{#set: gene associated=Ec-02_002970|Ec-02_002980}}
−
* BIGG : 40260
+
{{#set: in pathway=PWY-7646|PWY-6572}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02637 C02637]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C([O-])(=O)C1(=CC(=O)C(O)C(O)C1)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=SLWWJZMPHJJOPH-PHDIDXHHSA-M}}
+
−
{{#set: common name=3-dehydroshikimate}}
+
−
{{#set: molecular weight=171.129    }}
+
−
{{#set: common name=3-dehydroshikimic acid|5-dehydroshikimic acid|5-dehydroshikimate}}
+
−
{{#set: consumed by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
+
−
{{#set: produced by=RXN-7968}}
+
−
{{#set: reversible reaction associated=3-DEHYDROQUINATE-DEHYDRATASE-RXN}}
+

Revision as of 14:29, 21 March 2018

Reaction RXN-12178

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycosyl hydrolase, family 88
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine[c] + 1 H2O[c] => 1 4-deoxy-L-threo-hex-4-enopyranuronate[c] + 1 N-acetyl-D-galactosamine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7646, dermatan sulfate degradation I (bacterial): PWY-7646
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-6572, chondroitin sulfate degradation I (bacterial): PWY-6572
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6470&oldid=19055"