Difference between revisions of "PWY-702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-30...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063] ==
−
* smiles:
+
* taxonomic range:
−
** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
** InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** octoketide
+
** phytyl diphosphate biosynthesis
−
* molecular weight:
+
−
** 317.274   
+
 
* Synonym(s):
 
* Synonym(s):
−
** SEK4
+
** phytyl pyrophosphate biosynthesis
 +
** phytyl-PP biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN-10734]]
+
* [[RXN-7658]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-03_003520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7659]]
 +
** 1 associated gene(s):
 +
*** [[Ec-03_003520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7660]]
 +
** 1 associated gene(s):
 +
*** [[Ec-03_003520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237243 44237243]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5063 PWY-5063]
−
{{#set: smiles=CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))}}
+
{{#set: taxonomic range=TAX-3041}}
−
{{#set: inchi key=InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M}}
+
{{#set: taxonomic range=TAX-2763}}
−
{{#set: common name=octoketide}}
+
{{#set: taxonomic range=TAX-1117}}
−
{{#set: molecular weight=317.274    }}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: common name=SEK4}}
+
{{#set: common name=phytyl diphosphate biosynthesis}}
−
{{#set: produced by=RXN-10734}}
+
{{#set: common name=phytyl pyrophosphate biosynthesis|phytyl-PP biosynthesis}}
 +
{{#set: reaction found=3}}
 +
{{#set: total reaction=3}}
 +
{{#set: completion rate=100.0}}

Revision as of 13:31, 21 March 2018

Pathway PWY-5063

  • taxonomic range:
  • common name:
    • phytyl diphosphate biosynthesis
  • Synonym(s):
    • phytyl pyrophosphate biosynthesis
    • phytyl-PP biosynthesis

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-702&oldid=19301"