Difference between revisions of "Ec-14 005680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SAICARSYN-RXN SAICARSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SAICARSYN-RXN SAICARSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/6.3.2.6 EC-6.3.2.6]
+
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
 +
* common name:
 +
** aldehydo-D-glucuronate
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
 +
** aldehydo-D-glucuronic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[L-ASPARTATE]][c] '''+''' 1 [[PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14693]]
−
** 1 ATP[c] '''+''' 1 L-aspartate[c] '''+''' 1 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate[c] '''=>''' 1 ADP[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 5'-phosphoribosyl-4-(N-succinocarboxamide)-5-aminoimidazole[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6123]], inosine-5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6124]], inosine-5'-phosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6124 PWY-6124]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7234]], inosine-5'-phosphate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22628 22628]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04591 R04591]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
−
* UNIPROT:
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q07296 Q07296]
+
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9PHZ9 Q9PHZ9]
+
{{#set: common name=aldehydo-D-glucuronate}}
−
** [http://www.uniprot.org/uniprot/P0A7D7 P0A7D7]
+
{{#set: molecular weight=193.133    }}
−
** [http://www.uniprot.org/uniprot/P12046 P12046]
+
{{#set: common name=aldehydo-D-glucuronic acid}}
−
** [http://www.uniprot.org/uniprot/Q58987 Q58987]
+
{{#set: reversible reaction associated=RXN-14693}}
−
** [http://www.uniprot.org/uniprot/Q9JV73 Q9JV73]
+
−
** [http://www.uniprot.org/uniprot/P50124 P50124]
+
−
** [http://www.uniprot.org/uniprot/P27602 P27602]
+
−
** [http://www.uniprot.org/uniprot/P27616 P27616]
+
−
** [http://www.uniprot.org/uniprot/P22234 P22234]
+
−
** [http://www.uniprot.org/uniprot/P73471 P73471]
+
−
** [http://www.uniprot.org/uniprot/Q9R7D5 Q9R7D5]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-6.3.2.6}}
+
−
{{#set: in pathway=PWY-6123|PWY-6124|PWY-7234}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:31, 21 March 2018

Metabolite CPD-15530

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
  • common name:
    • aldehydo-D-glucuronate
  • molecular weight:
    • 193.133
  • Synonym(s):
    • aldehydo-D-glucuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_005680&oldid=19303"